About 4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid
4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 174952435) has the molecular formula C15H15ClO5
and a molecular weight of 310.73 g/mol. Its IUPAC name is 4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 174952435 |
| Molecular Formula | C15H15ClO5 |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | COC1(O)C=C(Cl)C(c2ccccc2)=CC1(OC)C(=O)O |
| InChI | InChI=1S/C15H15ClO5/c1-20-14(13(17)18)8-11(10-6-4-3-5-7-10)12(16)9-15(14,19)21-2/h3-9,19H,1-2H3,(H,17,18) |
| InChIKey | SDFBCTNCSDBWKG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid (CID 174952435) is 4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid is COC1(O)C=C(Cl)C(c2ccccc2)=CC1(OC)C(=O)O.
What is the InChIKey of 4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is SDFBCTNCSDBWKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClO5/c1-20-14(13(17)18)8-11(10-6-4-3-5-7-10)12(16)9-15(14,19)21-2/h3-9,19H,1-2H3,(H,17,18).
What are the key properties of 4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid?
4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 310.73 g/mol, XLogP of 2.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-hydroxy-1,6-dimethoxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 174952435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).