About methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane
methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane (PubChem CID 174952767) has the molecular formula C13H19NO5
and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane.
Molecular Properties
| Compound Name | methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane |
| PubChem CID | 174952767 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane |
| SMILES | C=C(CCN=C=O)C(=O)OC.C=CCOCC1CO1 |
| InChI | InChI=1S/C7H9NO3.C6H10O2/c1-6(7(10)11-2)3-4-8-5-9;1-2-3-7-4-6-5-8-6/h1,3-4H2,2H3;2,6H,1,3-5H2 |
| InChIKey | RVNPORQOTQIHPD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 77.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane?
The IUPAC name of methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane (CID 174952767) is methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane.
What is the SMILES notation for methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane?
The canonical SMILES for methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane is C=C(CCN=C=O)C(=O)OC.C=CCOCC1CO1.
What is the InChIKey of methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane?
The InChIKey is RVNPORQOTQIHPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3.C6H10O2/c1-6(7(10)11-2)3-4-8-5-9;1-2-3-7-4-6-5-8-6/h1,3-4H2,2H3;2,6H,1,3-5H2.
What are the key properties of methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane?
methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane has a molecular weight of 269.30 g/mol, XLogP of 1.03, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-isocyanato-2-methylidenebutanoate;2-(prop-2-enoxymethyl)oxirane is sourced from PubChem (CID 174952767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).