About dibromozinc;9-methylnonadecane
dibromozinc;9-methylnonadecane (PubChem CID 174952791) has the molecular formula C20H42Br2Zn
and a molecular weight of 507.75 g/mol. Its IUPAC name is dibromozinc;9-methylnonadecane.
Molecular Properties
| Compound Name | dibromozinc;9-methylnonadecane |
| PubChem CID | 174952791 |
| Molecular Formula | C20H42Br2Zn |
| Molecular Weight | 507.75 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | dibromozinc;9-methylnonadecane |
| SMILES | Br[Zn]Br.CCCCCCCCCCC(C)CCCCCCCC |
| InChI | InChI=1S/C20H42.2BrH.Zn/c1-4-6-8-10-12-13-15-17-19-20(3)18-16-14-11-9-7-5-2;;;/h20H,4-19H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | JDJQGTWKLMFLLH-UHFFFAOYSA-L |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.75 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dibromozinc;9-methylnonadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromozinc;9-methylnonadecane?
The IUPAC name of dibromozinc;9-methylnonadecane (CID 174952791) is dibromozinc;9-methylnonadecane.
What is the SMILES notation for dibromozinc;9-methylnonadecane?
The canonical SMILES for dibromozinc;9-methylnonadecane is Br[Zn]Br.CCCCCCCCCCC(C)CCCCCCCC.
What is the InChIKey of dibromozinc;9-methylnonadecane?
The InChIKey is JDJQGTWKLMFLLH-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H42.2BrH.Zn/c1-4-6-8-10-12-13-15-17-19-20(3)18-16-14-11-9-7-5-2;;;/h20H,4-19H2,1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of dibromozinc;9-methylnonadecane?
dibromozinc;9-methylnonadecane has a molecular weight of 507.75 g/mol, XLogP of 9.59, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibromozinc;9-methylnonadecane is sourced from PubChem (CID 174952791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).