About chloroselenonylbenzene;hydrofluoride
chloroselenonylbenzene;hydrofluoride (PubChem CID 174953141) has the molecular formula C6H6ClFO2Se
and a molecular weight of 243.52 g/mol. Its IUPAC name is chloroselenonylbenzene;hydrofluoride.
Molecular Properties
| Compound Name | chloroselenonylbenzene;hydrofluoride |
| PubChem CID | 174953141 |
| Molecular Formula | C6H6ClFO2Se |
| Molecular Weight | 243.52 g/mol |
| Exact Mass | 243.92 |
| IUPAC Name | chloroselenonylbenzene;hydrofluoride |
| SMILES | F.O=[Se](=O)(Cl)c1ccccc1 |
| InChI | InChI=1S/C6H5ClO2Se.FH/c7-10(8,9)6-4-2-1-3-5-6;/h1-5H;1H |
| InChIKey | WIWPOQZAQIVXLI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.52 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chloroselenonylbenzene;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroselenonylbenzene;hydrofluoride?
The IUPAC name of chloroselenonylbenzene;hydrofluoride (CID 174953141) is chloroselenonylbenzene;hydrofluoride.
What is the SMILES notation for chloroselenonylbenzene;hydrofluoride?
The canonical SMILES for chloroselenonylbenzene;hydrofluoride is F.O=[Se](=O)(Cl)c1ccccc1.
What is the InChIKey of chloroselenonylbenzene;hydrofluoride?
The InChIKey is WIWPOQZAQIVXLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO2Se.FH/c7-10(8,9)6-4-2-1-3-5-6;/h1-5H;1H.
What are the key properties of chloroselenonylbenzene;hydrofluoride?
chloroselenonylbenzene;hydrofluoride has a molecular weight of 243.52 g/mol, XLogP of 1.08, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloroselenonylbenzene;hydrofluoride is sourced from PubChem (CID 174953141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).