About 4-amino-1,5-dihydroxypyrimidin-2-one
4-amino-1,5-dihydroxypyrimidin-2-one (PubChem CID 174953159) has the molecular formula C4H5N3O3
and a molecular weight of 143.10 g/mol. Its IUPAC name is 4-amino-1,5-dihydroxypyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-1,5-dihydroxypyrimidin-2-one |
| PubChem CID | 174953159 |
| Molecular Formula | C4H5N3O3 |
| Molecular Weight | 143.10 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | 4-amino-1,5-dihydroxypyrimidin-2-one |
| SMILES | Nc1nc(=O)n(O)cc1O |
| InChI | InChI=1S/C4H5N3O3/c5-3-2(8)1-7(10)4(9)6-3/h1,8,10H,(H2,5,6,9) |
| InChIKey | HGDMLQKXLMKACQ-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.10 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1,5-dihydroxypyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,5-dihydroxypyrimidin-2-one?
The IUPAC name of 4-amino-1,5-dihydroxypyrimidin-2-one (CID 174953159) is 4-amino-1,5-dihydroxypyrimidin-2-one.
What is the SMILES notation for 4-amino-1,5-dihydroxypyrimidin-2-one?
The canonical SMILES for 4-amino-1,5-dihydroxypyrimidin-2-one is Nc1nc(=O)n(O)cc1O.
What is the InChIKey of 4-amino-1,5-dihydroxypyrimidin-2-one?
The InChIKey is HGDMLQKXLMKACQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O3/c5-3-2(8)1-7(10)4(9)6-3/h1,8,10H,(H2,5,6,9).
What are the key properties of 4-amino-1,5-dihydroxypyrimidin-2-one?
4-amino-1,5-dihydroxypyrimidin-2-one has a molecular weight of 143.10 g/mol, XLogP of -1.23, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,5-dihydroxypyrimidin-2-one is sourced from PubChem (CID 174953159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).