About 4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid
4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 174953612) has the molecular formula C13H11ClO4
and a molecular weight of 266.68 g/mol. Its IUPAC name is 4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 174953612 |
| Molecular Formula | C13H11ClO4 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1C=C(c2ccccc2)C(Cl)=CC1(O)O |
| InChI | InChI=1S/C13H11ClO4/c14-11-7-13(17,18)10(12(15)16)6-9(11)8-4-2-1-3-5-8/h1-7,10,17-18H,(H,15,16) |
| InChIKey | ILWJQWWYGMBCNK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid (CID 174953612) is 4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1C=C(c2ccccc2)C(Cl)=CC1(O)O.
What is the InChIKey of 4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is ILWJQWWYGMBCNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClO4/c14-11-7-13(17,18)10(12(15)16)6-9(11)8-4-2-1-3-5-8/h1-7,10,17-18H,(H,15,16).
What are the key properties of 4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid?
4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 266.68 g/mol, XLogP of 1.59, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6,6-dihydroxy-3-phenylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 174953612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).