About (4-chloroanilino)urea;pyridine
(4-chloroanilino)urea;pyridine (PubChem CID 174954137) has the molecular formula C12H13ClN4O
and a molecular weight of 264.72 g/mol. Its IUPAC name is (4-chloroanilino)urea;pyridine.
Molecular Properties
| Compound Name | (4-chloroanilino)urea;pyridine |
| PubChem CID | 174954137 |
| Molecular Formula | C12H13ClN4O |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (4-chloroanilino)urea;pyridine |
| SMILES | NC(=O)NNc1ccc(Cl)cc1.c1ccncc1 |
| InChI | InChI=1S/C7H8ClN3O.C5H5N/c8-5-1-3-6(4-2-5)10-11-7(9)12;1-2-4-6-5-3-1/h1-4,10H,(H3,9,11,12);1-5H |
| InChIKey | GRYACTOAYMZHBL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-chloroanilino)urea;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloroanilino)urea;pyridine?
The IUPAC name of (4-chloroanilino)urea;pyridine (CID 174954137) is (4-chloroanilino)urea;pyridine.
What is the SMILES notation for (4-chloroanilino)urea;pyridine?
The canonical SMILES for (4-chloroanilino)urea;pyridine is NC(=O)NNc1ccc(Cl)cc1.c1ccncc1.
What is the InChIKey of (4-chloroanilino)urea;pyridine?
The InChIKey is GRYACTOAYMZHBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN3O.C5H5N/c8-5-1-3-6(4-2-5)10-11-7(9)12;1-2-4-6-5-3-1/h1-4,10H,(H3,9,11,12);1-5H.
What are the key properties of (4-chloroanilino)urea;pyridine?
(4-chloroanilino)urea;pyridine has a molecular weight of 264.72 g/mol, XLogP of 2.42, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloroanilino)urea;pyridine is sourced from PubChem (CID 174954137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).