C20H30BNO3 — CID 174954168
CID 174954168 (PubChem CID 174954168) has the molecular formula C20H30BNO3 and a molecular weight of 343.28 g/mol.
| Compound Name | CID 174954168 |
|---|---|
| PubChem CID | 174954168 |
| Molecular Formula | C20H30BNO3 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | — |
| SMILES | [B]C(CCCC)(CCCN1CCCC1c1cccc(OC)c1)C(=O)O |
| InChI | InChI=1S/C20H30BNO3/c1-3-4-11-20(21,19(23)24)12-7-14-22-13-6-10-18(22)16-8-5-9-17(15-16)25-2/h5,8-9,15,18H,3-4,6-7,10-14H2,1-2H3,(H,23,24) |
| InChIKey | WYVHJKQIPMAOMP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|