About acetonitrile;6-bromopyridin-2-amine
acetonitrile;6-bromopyridin-2-amine (PubChem CID 174954526) has the molecular formula C7H8BrN3
and a molecular weight of 214.07 g/mol. Its IUPAC name is acetonitrile;6-bromopyridin-2-amine.
Molecular Properties
| Compound Name | acetonitrile;6-bromopyridin-2-amine |
| PubChem CID | 174954526 |
| Molecular Formula | C7H8BrN3 |
| Molecular Weight | 214.07 g/mol |
| Exact Mass | 212.99 |
| IUPAC Name | acetonitrile;6-bromopyridin-2-amine |
| SMILES | CC#N.Nc1cccc(Br)n1 |
| InChI | InChI=1S/C5H5BrN2.C2H3N/c6-4-2-1-3-5(7)8-4;1-2-3/h1-3H,(H2,7,8);1H3 |
| InChIKey | FIZKQZCIASKXJR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.07 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;6-bromopyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;6-bromopyridin-2-amine?
The IUPAC name of acetonitrile;6-bromopyridin-2-amine (CID 174954526) is acetonitrile;6-bromopyridin-2-amine.
What is the SMILES notation for acetonitrile;6-bromopyridin-2-amine?
The canonical SMILES for acetonitrile;6-bromopyridin-2-amine is CC#N.Nc1cccc(Br)n1.
What is the InChIKey of acetonitrile;6-bromopyridin-2-amine?
The InChIKey is FIZKQZCIASKXJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BrN2.C2H3N/c6-4-2-1-3-5(7)8-4;1-2-3/h1-3H,(H2,7,8);1H3.
What are the key properties of acetonitrile;6-bromopyridin-2-amine?
acetonitrile;6-bromopyridin-2-amine has a molecular weight of 214.07 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;6-bromopyridin-2-amine is sourced from PubChem (CID 174954526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).