About [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate
[1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate (PubChem CID 17495473) has the molecular formula C14H12F2N2O3
and a molecular weight of 294.26 g/mol. Its IUPAC name is [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate |
| PubChem CID | 17495473 |
| Molecular Formula | C14H12F2N2O3 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc[nH]1)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C14H12F2N2O3/c1-8(21-14(20)11-3-2-6-17-11)13(19)18-12-7-9(15)4-5-10(12)16/h2-8,17H,1H3,(H,18,19) |
| InChIKey | OMVPITCETDVONQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate?
The IUPAC name of [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate (CID 17495473) is [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate.
What is the SMILES notation for [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate?
The canonical SMILES for [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate is CC(OC(=O)c1ccc[nH]1)C(=O)Nc1cc(F)ccc1F.
What is the InChIKey of [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate?
The InChIKey is OMVPITCETDVONQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2N2O3/c1-8(21-14(20)11-3-2-6-17-11)13(19)18-12-7-9(15)4-5-10(12)16/h2-8,17H,1H3,(H,18,19).
What are the key properties of [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate?
[1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate has a molecular weight of 294.26 g/mol, XLogP of 2.48, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate is sourced from PubChem (CID 17495473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).