C25H32O5 — CID 174954762
[4,4-bis[3-(oxiran-2-ylmethoxy)propyl]cyclohexa-1,5-dien-1-yl]-phenylmethanone (PubChem CID 174954762) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is [4,4-bis[3-(oxiran-2-ylmethoxy)propyl]cyclohexa-1,5-dien-1-yl]-phenylmethanone.
| Compound Name | [4,4-bis[3-(oxiran-2-ylmethoxy)propyl]cyclohexa-1,5-dien-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 174954762 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [4,4-bis[3-(oxiran-2-ylmethoxy)propyl]cyclohexa-1,5-dien-1-yl]-phenylmethanone |
| SMILES | O=C(C1=CCC(CCCOCC2CO2)(CCCOCC2CO2)C=C1)c1ccccc1 |
| InChI | InChI=1S/C25H32O5/c26-24(20-6-2-1-3-7-20)21-8-12-25(13-9-21,10-4-14-27-16-22-18-29-22)11-5-15-28-17-23-19-30-23/h1-3,6-9,12,22-23H,4-5,10-11,13-19H2 |
| InChIKey | IGZXONYGLNAVQU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|