About (3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate
(3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate (PubChem CID 17495492) has the molecular formula C14H11BrFNO4S
and a molecular weight of 388.21 g/mol. Its IUPAC name is (3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate.
Molecular Properties
| Compound Name | (3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate |
| PubChem CID | 17495492 |
| Molecular Formula | C14H11BrFNO4S |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | (3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(F)c(C(=O)OCc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C14H11BrFNO4S/c15-10-3-1-2-9(6-10)8-21-14(18)12-7-11(22(17,19)20)4-5-13(12)16/h1-7H,8H2,(H2,17,19,20) |
| InChIKey | UMMMJIJUFMUSEI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate?
The IUPAC name of (3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate (CID 17495492) is (3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate.
What is the SMILES notation for (3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate?
The canonical SMILES for (3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate is NS(=O)(=O)c1ccc(F)c(C(=O)OCc2cccc(Br)c2)c1.
What is the InChIKey of (3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate?
The InChIKey is UMMMJIJUFMUSEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrFNO4S/c15-10-3-1-2-9(6-10)8-21-14(18)12-7-11(22(17,19)20)4-5-13(12)16/h1-7H,8H2,(H2,17,19,20).
What are the key properties of (3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate?
(3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate has a molecular weight of 388.21 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)methyl 2-fluoro-5-sulfamoylbenzoate is sourced from PubChem (CID 17495492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).