About 3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide
3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide (PubChem CID 174955707) has the molecular formula C21H26IN3S
and a molecular weight of 479.43 g/mol. Its IUPAC name is 3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide.
Molecular Properties
| Compound Name | 3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide |
| PubChem CID | 174955707 |
| Molecular Formula | C21H26IN3S |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide |
| SMILES | CCN1c2ccccc2SC1C=Cc1ccc(N2CCNCC2)cc1.I |
| InChI | InChI=1S/C21H25N3S.HI/c1-2-24-19-5-3-4-6-20(19)25-21(24)12-9-17-7-10-18(11-8-17)23-15-13-22-14-16-23;/h3-12,21-22H,2,13-16H2,1H3;1H |
| InChIKey | KDPHSJJRQHWCPH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide?
The IUPAC name of 3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide (CID 174955707) is 3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide.
What is the SMILES notation for 3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide?
The canonical SMILES for 3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide is CCN1c2ccccc2SC1C=Cc1ccc(N2CCNCC2)cc1.I.
What is the InChIKey of 3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide?
The InChIKey is KDPHSJJRQHWCPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3S.HI/c1-2-24-19-5-3-4-6-20(19)25-21(24)12-9-17-7-10-18(11-8-17)23-15-13-22-14-16-23;/h3-12,21-22H,2,13-16H2,1H3;1H.
What are the key properties of 3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide?
3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide has a molecular weight of 479.43 g/mol, XLogP of 4.69, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-[2-(4-piperazin-1-ylphenyl)ethenyl]-2H-1,3-benzothiazole;hydroiodide is sourced from PubChem (CID 174955707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).