About carboxysulfanylformic acid;1H-imidazole
carboxysulfanylformic acid;1H-imidazole (PubChem CID 174956051) has the molecular formula C5H6N2O4S
and a molecular weight of 190.18 g/mol. Its IUPAC name is carboxysulfanylformic acid;1H-imidazole.
Molecular Properties
| Compound Name | carboxysulfanylformic acid;1H-imidazole |
| PubChem CID | 174956051 |
| Molecular Formula | C5H6N2O4S |
| Molecular Weight | 190.18 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | carboxysulfanylformic acid;1H-imidazole |
| SMILES | O=C(O)SC(=O)O.c1c[nH]cn1 |
| InChI | InChI=1S/C3H4N2.C2H2O4S/c1-2-5-3-4-1;3-1(4)7-2(5)6/h1-3H,(H,4,5);(H,3,4)(H,5,6) |
| InChIKey | KMKNGLDAOUBILY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.18 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze carboxysulfanylformic acid;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxysulfanylformic acid;1H-imidazole?
The IUPAC name of carboxysulfanylformic acid;1H-imidazole (CID 174956051) is carboxysulfanylformic acid;1H-imidazole.
What is the SMILES notation for carboxysulfanylformic acid;1H-imidazole?
The canonical SMILES for carboxysulfanylformic acid;1H-imidazole is O=C(O)SC(=O)O.c1c[nH]cn1.
What is the InChIKey of carboxysulfanylformic acid;1H-imidazole?
The InChIKey is KMKNGLDAOUBILY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.C2H2O4S/c1-2-5-3-4-1;3-1(4)7-2(5)6/h1-3H,(H,4,5);(H,3,4)(H,5,6).
What are the key properties of carboxysulfanylformic acid;1H-imidazole?
carboxysulfanylformic acid;1H-imidazole has a molecular weight of 190.18 g/mol, XLogP of 1.49, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carboxysulfanylformic acid;1H-imidazole is sourced from PubChem (CID 174956051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).