About 1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine
1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 174956286) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine |
| PubChem CID | 174956286 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)C1C=CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C14H19N/c1-12(2)13-7-6-10-15(11-13)14-8-4-3-5-9-14/h3-9,12-13H,10-11H2,1-2H3 |
| InChIKey | FFOVMWWSEJLRIM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine (CID 174956286) is 1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine is CC(C)C1C=CCN(c2ccccc2)C1.
What is the InChIKey of 1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine?
The InChIKey is FFOVMWWSEJLRIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-12(2)13-7-6-10-15(11-13)14-8-4-3-5-9-14/h3-9,12-13H,10-11H2,1-2H3.
What are the key properties of 1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine?
1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine has a molecular weight of 201.31 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3-propan-2-yl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 174956286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).