C20H13N5O2 — CID 174956323
N-[4-[(3,4-dicyanophenyl)methoxy]phenyl]pyrazine-2-carboxamide (PubChem CID 174956323) has the molecular formula C20H13N5O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is N-[4-[(3,4-dicyanophenyl)methoxy]phenyl]pyrazine-2-carboxamide.
| Compound Name | N-[4-[(3,4-dicyanophenyl)methoxy]phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174956323 |
| Molecular Formula | C20H13N5O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[4-[(3,4-dicyanophenyl)methoxy]phenyl]pyrazine-2-carboxamide |
| SMILES | N#Cc1ccc(COc2ccc(NC(=O)c3cnccn3)cc2)cc1C#N |
| InChI | InChI=1S/C20H13N5O2/c21-10-15-2-1-14(9-16(15)11-22)13-27-18-5-3-17(4-6-18)25-20(26)19-12-23-7-8-24-19/h1-9,12H,13H2,(H,25,26) |
| InChIKey | JFXYBPBBLZQTCF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |