About 1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate
1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate (PubChem CID 174956406) has the molecular formula C14H24O6
and a molecular weight of 288.34 g/mol. Its IUPAC name is 1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate |
| PubChem CID | 174956406 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(CC)C(=O)OOC(C)OCC |
| InChI | InChI=1S/C9H16O4.C5H8O2/c1-5-7(3)9(10)13-12-8(4)11-6-2;1-4(2)5(6)7-3/h8H,3,5-6H2,1-2,4H3;1H2,2-3H3 |
| InChIKey | VNSBNEASMPQOIK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate?
The IUPAC name of 1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate (CID 174956406) is 1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate.
What is the SMILES notation for 1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate?
The canonical SMILES for 1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate is C=C(C)C(=O)OC.C=C(CC)C(=O)OOC(C)OCC.
What is the InChIKey of 1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate?
The InChIKey is VNSBNEASMPQOIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.C5H8O2/c1-5-7(3)9(10)13-12-8(4)11-6-2;1-4(2)5(6)7-3/h8H,3,5-6H2,1-2,4H3;1H2,2-3H3.
What are the key properties of 1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate?
1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate has a molecular weight of 288.34 g/mol, XLogP of 2.55, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethyl 2-methylidenebutaneperoxoate;methyl 2-methylprop-2-enoate is sourced from PubChem (CID 174956406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).