About 5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene
5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene (PubChem CID 174956679) has the molecular formula C21H23BrN2O2S
and a molecular weight of 447.40 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene.
Molecular Properties
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene |
| PubChem CID | 174956679 |
| Molecular Formula | C21H23BrN2O2S |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene |
| SMILES | Brc1ccccc1.CC(C)(C)c1nc(N)sc1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H18N2O2S.C6H5Br/c1-15(2,3)13-12(20-14(16)17-13)7-9-4-5-10-11(6-9)19-8-18-10;7-6-4-2-1-3-5-6/h4-6H,7-8H2,1-3H3,(H2,16,17);1-5H |
| InChIKey | JAICSHLLIZBRSP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene?
The IUPAC name of 5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene (CID 174956679) is 5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene.
What is the SMILES notation for 5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene?
The canonical SMILES for 5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene is Brc1ccccc1.CC(C)(C)c1nc(N)sc1Cc1ccc2c(c1)OCO2.
What is the InChIKey of 5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene?
The InChIKey is JAICSHLLIZBRSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2S.C6H5Br/c1-15(2,3)13-12(20-14(16)17-13)7-9-4-5-10-11(6-9)19-8-18-10;7-6-4-2-1-3-5-6/h4-6H,7-8H2,1-3H3,(H2,16,17);1-5H.
What are the key properties of 5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene?
5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene has a molecular weight of 447.40 g/mol, XLogP of 5.79, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-amine;bromobenzene is sourced from PubChem (CID 174956679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).