C12H20ClNO3 — CID 174956794
ethanol;methyl 2-amino-3-phenylpropanoate;hydrochloride (PubChem CID 174956794) has the molecular formula C12H20ClNO3 and a molecular weight of 261.75 g/mol. Its IUPAC name is ethanol;methyl 2-amino-3-phenylpropanoate;hydrochloride.
| Compound Name | ethanol;methyl 2-amino-3-phenylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 174956794 |
| Molecular Formula | C12H20ClNO3 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | ethanol;methyl 2-amino-3-phenylpropanoate;hydrochloride |
| SMILES | CCO.COC(=O)C(N)Cc1ccccc1.Cl |
| InChI | InChI=1S/C10H13NO2.C2H6O.ClH/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;1-2-3;/h2-6,9H,7,11H2,1H3;3H,2H2,1H3;1H |
| InChIKey | DPPNFIHOHRXSQB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |