About 2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide
2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide (PubChem CID 174956951) has the molecular formula C13H16N4O
and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide |
| PubChem CID | 174956951 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide |
| SMILES | C=CC1N(C)C(C(N)=O)=C(C)N1c1cccnc1 |
| InChI | InChI=1S/C13H16N4O/c1-4-11-16(3)12(13(14)18)9(2)17(11)10-6-5-7-15-8-10/h4-8,11H,1H2,2-3H3,(H2,14,18) |
| InChIKey | YTIPWUGQWJPGOB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide?
The IUPAC name of 2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide (CID 174956951) is 2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide.
What is the SMILES notation for 2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide?
The canonical SMILES for 2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide is C=CC1N(C)C(C(N)=O)=C(C)N1c1cccnc1.
What is the InChIKey of 2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide?
The InChIKey is YTIPWUGQWJPGOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O/c1-4-11-16(3)12(13(14)18)9(2)17(11)10-6-5-7-15-8-10/h4-8,11H,1H2,2-3H3,(H2,14,18).
What are the key properties of 2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide?
2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide has a molecular weight of 244.30 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-3,5-dimethyl-1-pyridin-3-yl-2H-imidazole-4-carboxamide is sourced from PubChem (CID 174956951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).