C22H33N3O2 — CID 174957648
propan-2-yl 2-[1-[4-(dimethylamino)piperidin-1-yl]ethyl]-6-methylindolizine-7-carboxylate (PubChem CID 174957648) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is propan-2-yl 2-[1-[4-(dimethylamino)piperidin-1-yl]ethyl]-6-methylindolizine-7-carboxylate.
| Compound Name | propan-2-yl 2-[1-[4-(dimethylamino)piperidin-1-yl]ethyl]-6-methylindolizine-7-carboxylate |
|---|---|
| PubChem CID | 174957648 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | propan-2-yl 2-[1-[4-(dimethylamino)piperidin-1-yl]ethyl]-6-methylindolizine-7-carboxylate |
| SMILES | Cc1cn2cc(C(C)N3CCC(N(C)C)CC3)cc2cc1C(=O)OC(C)C |
| InChI | InChI=1S/C22H33N3O2/c1-15(2)27-22(26)21-12-20-11-18(14-25(20)13-16(21)3)17(4)24-9-7-19(8-10-24)23(5)6/h11-15,17,19H,7-10H2,1-6H3 |
| InChIKey | RXYWNKQZJFMARI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |