C24H50O2 — CID 174958123
3-tert-butyl-2,4,4-trimethylpent-2-ene;4,5,5,6,6-pentamethylheptane-3,4-diol (PubChem CID 174958123) has the molecular formula C24H50O2 and a molecular weight of 370.66 g/mol. Its IUPAC name is 3-tert-butyl-2,4,4-trimethylpent-2-ene;4,5,5,6,6-pentamethylheptane-3,4-diol.
| Compound Name | 3-tert-butyl-2,4,4-trimethylpent-2-ene;4,5,5,6,6-pentamethylheptane-3,4-diol |
|---|---|
| PubChem CID | 174958123 |
| Molecular Formula | C24H50O2 |
| Molecular Weight | 370.66 g/mol |
| Exact Mass | 370.38 |
| IUPAC Name | 3-tert-butyl-2,4,4-trimethylpent-2-ene;4,5,5,6,6-pentamethylheptane-3,4-diol |
| SMILES | CC(C)=C(C(C)(C)C)C(C)(C)C.CCC(O)C(C)(O)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H26O2.C12H24/c1-8-9(13)12(7,14)11(5,6)10(2,3)4;1-9(2)10(11(3,4)5)12(6,7)8/h9,13-14H,8H2,1-7H3;1-8H3 |
| InChIKey | LWDMZTQMIIDXAO-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.66 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|