C25H23NO — CID 174958363
N,N-diphenylaniline;phenylmethanol (PubChem CID 174958363) has the molecular formula C25H23NO and a molecular weight of 353.47 g/mol. Its IUPAC name is N,N-diphenylaniline;phenylmethanol.
| Compound Name | N,N-diphenylaniline;phenylmethanol |
|---|---|
| PubChem CID | 174958363 |
| Molecular Formula | C25H23NO |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N,N-diphenylaniline;phenylmethanol |
| SMILES | OCc1ccccc1.c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N.C7H8O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-6-7-4-2-1-3-5-7/h1-15H;1-5,8H,6H2 |
| InChIKey | KUGYUQPQPUQZOH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |