About hydron;N-(1,6-naphthyridin-3-yl)formamide
hydron;N-(1,6-naphthyridin-3-yl)formamide (PubChem CID 174959508) has the molecular formula C9H8N3O+
and a molecular weight of 174.18 g/mol. Its IUPAC name is hydron;N-(1,6-naphthyridin-3-yl)formamide.
Molecular Properties
| Compound Name | hydron;N-(1,6-naphthyridin-3-yl)formamide |
| PubChem CID | 174959508 |
| Molecular Formula | C9H8N3O+ |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | hydron;N-(1,6-naphthyridin-3-yl)formamide |
| SMILES | O=CNc1cnc2ccncc2c1.[H+] |
| InChI | InChI=1S/C9H7N3O/c13-6-12-8-3-7-4-10-2-1-9(7)11-5-8/h1-6H,(H,12,13)/p+1 |
| InChIKey | BYOVIMVOUZHOLW-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze hydron;N-(1,6-naphthyridin-3-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;N-(1,6-naphthyridin-3-yl)formamide?
The IUPAC name of hydron;N-(1,6-naphthyridin-3-yl)formamide (CID 174959508) is hydron;N-(1,6-naphthyridin-3-yl)formamide.
What is the SMILES notation for hydron;N-(1,6-naphthyridin-3-yl)formamide?
The canonical SMILES for hydron;N-(1,6-naphthyridin-3-yl)formamide is O=CNc1cnc2ccncc2c1.[H+].
What is the InChIKey of hydron;N-(1,6-naphthyridin-3-yl)formamide?
The InChIKey is BYOVIMVOUZHOLW-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H7N3O/c13-6-12-8-3-7-4-10-2-1-9(7)11-5-8/h1-6H,(H,12,13)/p+1.
What are the key properties of hydron;N-(1,6-naphthyridin-3-yl)formamide?
hydron;N-(1,6-naphthyridin-3-yl)formamide has a molecular weight of 174.18 g/mol, XLogP of 1.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;N-(1,6-naphthyridin-3-yl)formamide is sourced from PubChem (CID 174959508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).