About N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide
N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 17495959) has the molecular formula C10H17N3O4S
and a molecular weight of 275.33 g/mol. Its IUPAC name is N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| PubChem CID | 17495959 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C10H17N3O4S/c1-4-5-6-11-18(16,17)8-7-12(2)10(15)13(3)9(8)14/h7,11H,4-6H2,1-3H3 |
| InChIKey | PIYJTQDBKGUHAF-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide?
The IUPAC name of N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (CID 17495959) is N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
What is the SMILES notation for N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide?
The canonical SMILES for N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide is CCCCNS(=O)(=O)c1cn(C)c(=O)n(C)c1=O.
What is the InChIKey of N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide?
The InChIKey is PIYJTQDBKGUHAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O4S/c1-4-5-6-11-18(16,17)8-7-12(2)10(15)13(3)9(8)14/h7,11H,4-6H2,1-3H3.
What are the key properties of N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide?
N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide has a molecular weight of 275.33 g/mol, XLogP of -0.84, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide is sourced from PubChem (CID 17495959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).