C24H24F3N3O — CID 174960011
3-anilino-6,6-dimethyl-2-pyridin-4-yl-1-(2,2,2-trifluoroethyl)-5,7-dihydro-4H-indole-4-carbaldehyde (PubChem CID 174960011) has the molecular formula C24H24F3N3O and a molecular weight of 427.47 g/mol. Its IUPAC name is 3-anilino-6,6-dimethyl-2-pyridin-4-yl-1-(2,2,2-trifluoroethyl)-5,7-dihydro-4H-indole-4-carbaldehyde.
| Compound Name | 3-anilino-6,6-dimethyl-2-pyridin-4-yl-1-(2,2,2-trifluoroethyl)-5,7-dihydro-4H-indole-4-carbaldehyde |
|---|---|
| PubChem CID | 174960011 |
| Molecular Formula | C24H24F3N3O |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-anilino-6,6-dimethyl-2-pyridin-4-yl-1-(2,2,2-trifluoroethyl)-5,7-dihydro-4H-indole-4-carbaldehyde |
| SMILES | CC1(C)Cc2c(c(Nc3ccccc3)c(-c3ccncc3)n2CC(F)(F)F)C(C=O)C1 |
| InChI | InChI=1S/C24H24F3N3O/c1-23(2)12-17(14-31)20-19(13-23)30(15-24(25,26)27)22(16-8-10-28-11-9-16)21(20)29-18-6-4-3-5-7-18/h3-11,14,17,29H,12-13,15H2,1-2H3 |
| InChIKey | RMTKXXVXULZGCT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|