About 1H-azirino[1,2-a]indole;1-chloropentane
1H-azirino[1,2-a]indole;1-chloropentane (PubChem CID 174960143) has the molecular formula C14H18ClN
and a molecular weight of 235.76 g/mol. Its IUPAC name is 1H-azirino[1,2-a]indole;1-chloropentane.
Molecular Properties
| Compound Name | 1H-azirino[1,2-a]indole;1-chloropentane |
| PubChem CID | 174960143 |
| Molecular Formula | C14H18ClN |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 1H-azirino[1,2-a]indole;1-chloropentane |
| SMILES | CCCCCCl.c1ccc2c(c1)cc1n2C1 |
| InChI | InChI=1S/C9H7N.C5H11Cl/c1-2-4-9-7(3-1)5-8-6-10(8)9;1-2-3-4-5-6/h1-5H,6H2;2-5H2,1H3 |
| InChIKey | ULPQXXYSIXPVKB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1H-azirino[1,2-a]indole;1-chloropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-azirino[1,2-a]indole;1-chloropentane?
The IUPAC name of 1H-azirino[1,2-a]indole;1-chloropentane (CID 174960143) is 1H-azirino[1,2-a]indole;1-chloropentane.
What is the SMILES notation for 1H-azirino[1,2-a]indole;1-chloropentane?
The canonical SMILES for 1H-azirino[1,2-a]indole;1-chloropentane is CCCCCCl.c1ccc2c(c1)cc1n2C1.
What is the InChIKey of 1H-azirino[1,2-a]indole;1-chloropentane?
The InChIKey is ULPQXXYSIXPVKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C5H11Cl/c1-2-4-9-7(3-1)5-8-6-10(8)9;1-2-3-4-5-6/h1-5H,6H2;2-5H2,1H3.
What are the key properties of 1H-azirino[1,2-a]indole;1-chloropentane?
1H-azirino[1,2-a]indole;1-chloropentane has a molecular weight of 235.76 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-azirino[1,2-a]indole;1-chloropentane is sourced from PubChem (CID 174960143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).