About hydron;isoquinolin-4-ol
hydron;isoquinolin-4-ol (PubChem CID 174960329) has the molecular formula C9H8NO+
and a molecular weight of 146.17 g/mol. Its IUPAC name is hydron;isoquinolin-4-ol.
Molecular Properties
| Compound Name | hydron;isoquinolin-4-ol |
| PubChem CID | 174960329 |
| Molecular Formula | C9H8NO+ |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | hydron;isoquinolin-4-ol |
| SMILES | Oc1cncc2ccccc12.[H+] |
| InChI | InChI=1S/C9H7NO/c11-9-6-10-5-7-3-1-2-4-8(7)9/h1-6,11H/p+1 |
| InChIKey | DXTUTXYCHFWRQC-UHFFFAOYSA-O |
| XLogP | 2.05 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hydron;isoquinolin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;isoquinolin-4-ol?
The IUPAC name of hydron;isoquinolin-4-ol (CID 174960329) is hydron;isoquinolin-4-ol.
What is the SMILES notation for hydron;isoquinolin-4-ol?
The canonical SMILES for hydron;isoquinolin-4-ol is Oc1cncc2ccccc12.[H+].
What is the InChIKey of hydron;isoquinolin-4-ol?
The InChIKey is DXTUTXYCHFWRQC-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H7NO/c11-9-6-10-5-7-3-1-2-4-8(7)9/h1-6,11H/p+1.
What are the key properties of hydron;isoquinolin-4-ol?
hydron;isoquinolin-4-ol has a molecular weight of 146.17 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;isoquinolin-4-ol is sourced from PubChem (CID 174960329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).