About chromen-4-one;fluorobenzene
chromen-4-one;fluorobenzene (PubChem CID 174960592) has the molecular formula C15H11FO2
and a molecular weight of 242.25 g/mol. Its IUPAC name is chromen-4-one;fluorobenzene.
Molecular Properties
| Compound Name | chromen-4-one;fluorobenzene |
| PubChem CID | 174960592 |
| Molecular Formula | C15H11FO2 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | chromen-4-one;fluorobenzene |
| SMILES | Fc1ccccc1.O=c1ccoc2ccccc12 |
| InChI | InChI=1S/C9H6O2.C6H5F/c10-8-5-6-11-9-4-2-1-3-7(8)9;7-6-4-2-1-3-5-6/h1-6H;1-5H |
| InChIKey | CPULKOZQNIULGZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chromen-4-one;fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-4-one;fluorobenzene?
The IUPAC name of chromen-4-one;fluorobenzene (CID 174960592) is chromen-4-one;fluorobenzene.
What is the SMILES notation for chromen-4-one;fluorobenzene?
The canonical SMILES for chromen-4-one;fluorobenzene is Fc1ccccc1.O=c1ccoc2ccccc12.
What is the InChIKey of chromen-4-one;fluorobenzene?
The InChIKey is CPULKOZQNIULGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2.C6H5F/c10-8-5-6-11-9-4-2-1-3-7(8)9;7-6-4-2-1-3-5-6/h1-6H;1-5H.
What are the key properties of chromen-4-one;fluorobenzene?
chromen-4-one;fluorobenzene has a molecular weight of 242.25 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-4-one;fluorobenzene is sourced from PubChem (CID 174960592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).