C13H18O6 — CID 174960758
7-methyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;oxolane-2,5-diol (PubChem CID 174960758) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is 7-methyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;oxolane-2,5-diol.
| Compound Name | 7-methyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;oxolane-2,5-diol |
|---|---|
| PubChem CID | 174960758 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 7-methyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;oxolane-2,5-diol |
| SMILES | CC1=CCCC2C(=O)OC(=O)C12.OC1CCC(O)O1 |
| InChI | InChI=1S/C9H10O3.C4H8O3/c1-5-3-2-4-6-7(5)9(11)12-8(6)10;5-3-1-2-4(6)7-3/h3,6-7H,2,4H2,1H3;3-6H,1-2H2 |
| InChIKey | DDUAPWSNAZSYPI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|