About 5-methyl-1,3,3a,7a-tetrahydro-2-benzofuran-4,7-dione
5-methyl-1,3,3a,7a-tetrahydro-2-benzofuran-4,7-dione (PubChem CID 174961267) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 5-methyl-1,3,3a,7a-tetrahydro-2-benzofuran-4,7-dione.
Analyze 5-methyl-1,3,3a,7a-tetrahydro-2-benzofuran-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,3,3a,7a-tetrahydro-2-benzofuran-4,7-dione?
The IUPAC name of 5-methyl-1,3,3a,7a-tetrahydro-2-benzofuran-4,7-dione (CID 174961267) is 5-methyl-1,3,3a,7a-tetrahydro-2-benzofuran-4,7-dione.
What is the SMILES notation for 5-methyl-1,3,3a,7a-tetrahydro-2-benzofuran-4,7-dione?
The canonical SMILES for 5-methyl-1,3,3a,7a-tetrahydro-2-benzofuran-4,7-dione is CC1=CC(=O)C2COCC2C1=O.
What is the InChIKey of 5-methyl-1,3,3a,7a-tetrahydro-2-benzofuran-4,7-dione?
The InChIKey is WTBZPOXIGKLIHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-5-2-8(10)6-3-12-4-7(6)9(5)11/h2,6-7H,3-4H2,1H3.
What are the key properties of 5-methyl-1,3,3a,7a-tetrahydro-2-benzofuran-4,7-dione?
5-methyl-1,3,3a,7a-tetrahydro-2-benzofuran-4,7-dione has a molecular weight of 166.18 g/mol, XLogP of 0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,3,3a,7a-tetrahydro-2-benzofuran-4,7-dione is sourced from PubChem (CID 174961267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).