About 2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol
2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol (PubChem CID 174961722) has the molecular formula C14H13F3OS
and a molecular weight of 286.32 g/mol. Its IUPAC name is 2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol.
Molecular Properties
| Compound Name | 2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol |
| PubChem CID | 174961722 |
| Molecular Formula | C14H13F3OS |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol |
| SMILES | Cc1cc(C(F)(F)F)ccc1-c1ccccc1.OS |
| InChI | InChI=1S/C14H11F3.H2OS/c1-10-9-12(14(15,16)17)7-8-13(10)11-5-3-2-4-6-11;1-2/h2-9H,1H3;1-2H |
| InChIKey | GNPMOPYVQWZCAG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol?
The IUPAC name of 2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol (CID 174961722) is 2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol.
What is the SMILES notation for 2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol?
The canonical SMILES for 2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol is Cc1cc(C(F)(F)F)ccc1-c1ccccc1.OS.
What is the InChIKey of 2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol?
The InChIKey is GNPMOPYVQWZCAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F3.H2OS/c1-10-9-12(14(15,16)17)7-8-13(10)11-5-3-2-4-6-11;1-2/h2-9H,1H3;1-2H.
What are the key properties of 2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol?
2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol has a molecular weight of 286.32 g/mol, XLogP of 5.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-phenyl-4-(trifluoromethyl)benzene;sulfanol is sourced from PubChem (CID 174961722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).