About tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine
tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine (PubChem CID 174961978) has the molecular formula C15H19F4NO2
and a molecular weight of 321.31 g/mol. Its IUPAC name is tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine.
Molecular Properties
| Compound Name | tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine |
| PubChem CID | 174961978 |
| Molecular Formula | C15H19F4NO2 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine |
| SMILES | CC(C)(C)OC=O.Fc1ccc(F)c(C2CC(F)(F)CN2)c1 |
| InChI | InChI=1S/C10H9F4N.C5H10O2/c11-6-1-2-8(12)7(3-6)9-4-10(13,14)5-15-9;1-5(2,3)7-4-6/h1-3,9,15H,4-5H2;4H,1-3H3 |
| InChIKey | OQLGMRZPQGNKSH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine?
The IUPAC name of tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine (CID 174961978) is tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine.
What is the SMILES notation for tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine?
The canonical SMILES for tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine is CC(C)(C)OC=O.Fc1ccc(F)c(C2CC(F)(F)CN2)c1.
What is the InChIKey of tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine?
The InChIKey is OQLGMRZPQGNKSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F4N.C5H10O2/c11-6-1-2-8(12)7(3-6)9-4-10(13,14)5-15-9;1-5(2,3)7-4-6/h1-3,9,15H,4-5H2;4H,1-3H3.
What are the key properties of tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine?
tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine has a molecular weight of 321.31 g/mol, XLogP of 3.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;2-(2,5-difluorophenyl)-4,4-difluoropyrrolidine is sourced from PubChem (CID 174961978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).