About 2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron
2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron (PubChem CID 174962215) has the molecular formula C14H18FeO2-6
and a molecular weight of 274.14 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron.
Molecular Properties
| Compound Name | 2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron |
| PubChem CID | 174962215 |
| Molecular Formula | C14H18FeO2-6 |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron |
| SMILES | OCC[c-]1[cH-][cH-][cH-][cH-]1.OCC[c-]1cccc1.[Fe] |
| InChI | InChI=1S/2C7H9O.Fe/c2*8-6-5-7-3-1-2-4-7;/h2*1-4,8H,5-6H2;/q-5;-1; |
| InChIKey | OKACHDZSNVVCLH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron?
The IUPAC name of 2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron (CID 174962215) is 2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron.
What is the SMILES notation for 2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron?
The canonical SMILES for 2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron is OCC[c-]1[cH-][cH-][cH-][cH-]1.OCC[c-]1cccc1.[Fe].
What is the InChIKey of 2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron?
The InChIKey is OKACHDZSNVVCLH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H9O.Fe/c2*8-6-5-7-3-1-2-4-7;/h2*1-4,8H,5-6H2;/q-5;-1;.
What are the key properties of 2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron?
2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron has a molecular weight of 274.14 g/mol, XLogP of 1.88, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-2,4-dien-1-ylethanol;2-cyclopentylethanol;iron is sourced from PubChem (CID 174962215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).