About tert-butylbenzene;3-methylideneisoindol-1-one
tert-butylbenzene;3-methylideneisoindol-1-one (PubChem CID 174962227) has the molecular formula C19H21NO
and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butylbenzene;3-methylideneisoindol-1-one.
Molecular Properties
| Compound Name | tert-butylbenzene;3-methylideneisoindol-1-one |
| PubChem CID | 174962227 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | tert-butylbenzene;3-methylideneisoindol-1-one |
| SMILES | C=C1NC(=O)c2ccccc21.CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C10H14.C9H7NO/c1-10(2,3)9-7-5-4-6-8-9;1-6-7-4-2-3-5-8(7)9(11)10-6/h4-8H,1-3H3;2-5H,1H2,(H,10,11) |
| InChIKey | PGIMLFVQLNAAIR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tert-butylbenzene;3-methylideneisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylbenzene;3-methylideneisoindol-1-one?
The IUPAC name of tert-butylbenzene;3-methylideneisoindol-1-one (CID 174962227) is tert-butylbenzene;3-methylideneisoindol-1-one.
What is the SMILES notation for tert-butylbenzene;3-methylideneisoindol-1-one?
The canonical SMILES for tert-butylbenzene;3-methylideneisoindol-1-one is C=C1NC(=O)c2ccccc21.CC(C)(C)c1ccccc1.
What is the InChIKey of tert-butylbenzene;3-methylideneisoindol-1-one?
The InChIKey is PGIMLFVQLNAAIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C9H7NO/c1-10(2,3)9-7-5-4-6-8-9;1-6-7-4-2-3-5-8(7)9(11)10-6/h4-8H,1-3H3;2-5H,1H2,(H,10,11).
What are the key properties of tert-butylbenzene;3-methylideneisoindol-1-one?
tert-butylbenzene;3-methylideneisoindol-1-one has a molecular weight of 279.38 g/mol, XLogP of 4.38, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylbenzene;3-methylideneisoindol-1-one is sourced from PubChem (CID 174962227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).