About (5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate
(5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate (PubChem CID 174962332) has the molecular formula C8H5ClN2O4S3
and a molecular weight of 324.79 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | (5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate |
| PubChem CID | 174962332 |
| Molecular Formula | C8H5ClN2O4S3 |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 323.91 |
| IUPAC Name | (5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate |
| SMILES | O=C(OS(=O)(=O)Nc1ccc(Cl)s1)c1cscn1 |
| InChI | InChI=1S/C8H5ClN2O4S3/c9-6-1-2-7(17-6)11-18(13,14)15-8(12)5-3-16-4-10-5/h1-4,11H |
| InChIKey | ATFIVJJGYNTHGI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate?
The IUPAC name of (5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate (CID 174962332) is (5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate.
What is the SMILES notation for (5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate?
The canonical SMILES for (5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate is O=C(OS(=O)(=O)Nc1ccc(Cl)s1)c1cscn1.
What is the InChIKey of (5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate?
The InChIKey is ATFIVJJGYNTHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O4S3/c9-6-1-2-7(17-6)11-18(13,14)15-8(12)5-3-16-4-10-5/h1-4,11H.
What are the key properties of (5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate?
(5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate has a molecular weight of 324.79 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chlorothiophen-2-yl)sulfamoyl 1,3-thiazole-4-carboxylate is sourced from PubChem (CID 174962332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).