About sodium;dihydrogen phosphate;1H-imidazole
sodium;dihydrogen phosphate;1H-imidazole (PubChem CID 174962413) has the molecular formula C3H6N2NaO4P
and a molecular weight of 188.06 g/mol. Its IUPAC name is sodium;dihydrogen phosphate;1H-imidazole.
Molecular Properties
| Compound Name | sodium;dihydrogen phosphate;1H-imidazole |
| PubChem CID | 174962413 |
| Molecular Formula | C3H6N2NaO4P |
| Molecular Weight | 188.06 g/mol |
| Exact Mass | 188.00 |
| IUPAC Name | sodium;dihydrogen phosphate;1H-imidazole |
| SMILES | O=P([O-])(O)O.[Na+].c1c[nH]cn1 |
| InChI | InChI=1S/C3H4N2.Na.H3O4P/c1-2-5-3-4-1;;1-5(2,3)4/h1-3H,(H,4,5);;(H3,1,2,3,4)/q;+1;/p-1 |
| InChIKey | NFYNEWCDMKNLIU-UHFFFAOYSA-M |
| XLogP | -4.15 |
| TPSA | 109.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.06 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;dihydrogen phosphate;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dihydrogen phosphate;1H-imidazole?
The IUPAC name of sodium;dihydrogen phosphate;1H-imidazole (CID 174962413) is sodium;dihydrogen phosphate;1H-imidazole.
What is the SMILES notation for sodium;dihydrogen phosphate;1H-imidazole?
The canonical SMILES for sodium;dihydrogen phosphate;1H-imidazole is O=P([O-])(O)O.[Na+].c1c[nH]cn1.
What is the InChIKey of sodium;dihydrogen phosphate;1H-imidazole?
The InChIKey is NFYNEWCDMKNLIU-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H4N2.Na.H3O4P/c1-2-5-3-4-1;;1-5(2,3)4/h1-3H,(H,4,5);;(H3,1,2,3,4)/q;+1;/p-1.
What are the key properties of sodium;dihydrogen phosphate;1H-imidazole?
sodium;dihydrogen phosphate;1H-imidazole has a molecular weight of 188.06 g/mol, XLogP of -4.15, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dihydrogen phosphate;1H-imidazole is sourced from PubChem (CID 174962413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).