About N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine
N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine (PubChem CID 174962993) has the molecular formula C24H21BrIN3O
and a molecular weight of 574.26 g/mol. Its IUPAC name is N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine.
Molecular Properties
| Compound Name | N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine |
| PubChem CID | 174962993 |
| Molecular Formula | C24H21BrIN3O |
| Molecular Weight | 574.26 g/mol |
| Exact Mass | 572.99 |
| IUPAC Name | N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine |
| SMILES | Brc1ncc(OCc2ccccc2)cn1.Ic1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12IN.C11H9BrN2O/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;12-11-13-6-10(7-14-11)15-8-9-4-2-1-3-5-9/h1-9,15H,10H2;1-7H,8H2 |
| InChIKey | SGKBEEOZNVGOQF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 574.26 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine?
The IUPAC name of N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine (CID 174962993) is N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine.
What is the SMILES notation for N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine?
The canonical SMILES for N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine is Brc1ncc(OCc2ccccc2)cn1.Ic1ccc(NCc2ccccc2)cc1.
What is the InChIKey of N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine?
The InChIKey is SGKBEEOZNVGOQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12IN.C11H9BrN2O/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;12-11-13-6-10(7-14-11)15-8-9-4-2-1-3-5-9/h1-9,15H,10H2;1-7H,8H2.
What are the key properties of N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine?
N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine has a molecular weight of 574.26 g/mol, XLogP of 6.72, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-iodoaniline;2-bromo-5-phenylmethoxypyrimidine is sourced from PubChem (CID 174962993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).