C12H9F16NO3 — CID 174963307
N-(1,3-dihydroxy-2-methylpropan-2-yl)-N,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctanamide (PubChem CID 174963307) has the molecular formula C12H9F16NO3 and a molecular weight of 519.18 g/mol. Its IUPAC name is N-(1,3-dihydroxy-2-methylpropan-2-yl)-N,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctanamide.
| Compound Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)-N,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctanamide |
|---|---|
| PubChem CID | 174963307 |
| Molecular Formula | C12H9F16NO3 |
| Molecular Weight | 519.18 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)-N,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctanamide |
| SMILES | CC(CO)(CO)N(F)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F16NO3/c1-5(2-30,3-31)29(28)4(32)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)27/h30-31H,2-3H2,1H3 |
| InChIKey | QXXCXJAHSZZZBX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|