About sulfanyl 3-methylheptanoate
sulfanyl 3-methylheptanoate (PubChem CID 174963381) has the molecular formula C8H16O2S
and a molecular weight of 176.28 g/mol. Its IUPAC name is sulfanyl 3-methylheptanoate.
Molecular Properties
| Compound Name | sulfanyl 3-methylheptanoate |
| PubChem CID | 174963381 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | sulfanyl 3-methylheptanoate |
| SMILES | CCCCC(C)CC(=O)OS |
| InChI | InChI=1S/C8H16O2S/c1-3-4-5-7(2)6-8(9)10-11/h7,11H,3-6H2,1-2H3 |
| InChIKey | MZDBFVIFUASFPL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfanyl 3-methylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanyl 3-methylheptanoate?
The IUPAC name of sulfanyl 3-methylheptanoate (CID 174963381) is sulfanyl 3-methylheptanoate.
What is the SMILES notation for sulfanyl 3-methylheptanoate?
The canonical SMILES for sulfanyl 3-methylheptanoate is CCCCC(C)CC(=O)OS.
What is the InChIKey of sulfanyl 3-methylheptanoate?
The InChIKey is MZDBFVIFUASFPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2S/c1-3-4-5-7(2)6-8(9)10-11/h7,11H,3-6H2,1-2H3.
What are the key properties of sulfanyl 3-methylheptanoate?
sulfanyl 3-methylheptanoate has a molecular weight of 176.28 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanyl 3-methylheptanoate is sourced from PubChem (CID 174963381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).