About molecular hydrogen;2,3,4,5-tetramethylpyridine
molecular hydrogen;2,3,4,5-tetramethylpyridine (PubChem CID 174963511) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is molecular hydrogen;2,3,4,5-tetramethylpyridine.
Molecular Properties
| Compound Name | molecular hydrogen;2,3,4,5-tetramethylpyridine |
| PubChem CID | 174963511 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | molecular hydrogen;2,3,4,5-tetramethylpyridine |
| SMILES | Cc1cnc(C)c(C)c1C.[H][H] |
| InChI | InChI=1S/C9H13N.H2/c1-6-5-10-9(4)8(3)7(6)2;/h5H,1-4H3;1H |
| InChIKey | PGOOIPNKMBJNEN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze molecular hydrogen;2,3,4,5-tetramethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;2,3,4,5-tetramethylpyridine?
The IUPAC name of molecular hydrogen;2,3,4,5-tetramethylpyridine (CID 174963511) is molecular hydrogen;2,3,4,5-tetramethylpyridine.
What is the SMILES notation for molecular hydrogen;2,3,4,5-tetramethylpyridine?
The canonical SMILES for molecular hydrogen;2,3,4,5-tetramethylpyridine is Cc1cnc(C)c(C)c1C.[H][H].
What is the InChIKey of molecular hydrogen;2,3,4,5-tetramethylpyridine?
The InChIKey is PGOOIPNKMBJNEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.H2/c1-6-5-10-9(4)8(3)7(6)2;/h5H,1-4H3;1H.
What are the key properties of molecular hydrogen;2,3,4,5-tetramethylpyridine?
molecular hydrogen;2,3,4,5-tetramethylpyridine has a molecular weight of 137.23 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;2,3,4,5-tetramethylpyridine is sourced from PubChem (CID 174963511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).