molecular hydrogen;2,3,4,5-tetramethylpyridine

C9H15N — CID 174963511

IUPACmolecular hydrogen;2,3,4,5-tetramethylpyridine
SMILESCc1cnc(C)c(C)c1C.[H][H]
InChIInChI=1S/C9H13N.H2/c1-6-5-10-9(4)8(3)7(6)2;/h5H,1-4H3;1H
InChIKeyPGOOIPNKMBJNEN-UHFFFAOYSA-N
MW137.23 g/mol
LogP2.56
Rot. Bonds

About molecular hydrogen;2,3,4,5-tetramethylpyridine

molecular hydrogen;2,3,4,5-tetramethylpyridine (PubChem CID 174963511) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is molecular hydrogen;2,3,4,5-tetramethylpyridine.

Molecular Properties

Compound Namemolecular hydrogen;2,3,4,5-tetramethylpyridine
PubChem CID174963511
Molecular FormulaC9H15N
Molecular Weight137.23 g/mol
Exact Mass137.12
IUPAC Namemolecular hydrogen;2,3,4,5-tetramethylpyridine
SMILESCc1cnc(C)c(C)c1C.[H][H]
InChIInChI=1S/C9H13N.H2/c1-6-5-10-9(4)8(3)7(6)2;/h5H,1-4H3;1H
InChIKeyPGOOIPNKMBJNEN-UHFFFAOYSA-N
XLogP2.56
TPSA12.89 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500137.23
LogP ≤ 52.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze molecular hydrogen;2,3,4,5-tetramethylpyridine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;2,3,4,5-tetramethylpyridine?
The IUPAC name of molecular hydrogen;2,3,4,5-tetramethylpyridine (CID 174963511) is molecular hydrogen;2,3,4,5-tetramethylpyridine.
What is the SMILES notation for molecular hydrogen;2,3,4,5-tetramethylpyridine?
The canonical SMILES for molecular hydrogen;2,3,4,5-tetramethylpyridine is Cc1cnc(C)c(C)c1C.[H][H].
What is the InChIKey of molecular hydrogen;2,3,4,5-tetramethylpyridine?
The InChIKey is PGOOIPNKMBJNEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.H2/c1-6-5-10-9(4)8(3)7(6)2;/h5H,1-4H3;1H.
What are the key properties of molecular hydrogen;2,3,4,5-tetramethylpyridine?
molecular hydrogen;2,3,4,5-tetramethylpyridine has a molecular weight of 137.23 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;2,3,4,5-tetramethylpyridine is sourced from PubChem (CID 174963511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).