C10H18N4O6S — CID 174963643
2-amino-3-[2-carboxy-2-(methylamino)ethyl]sulfanylpropanoic acid;imidazolidine-2,4-dione (PubChem CID 174963643) has the molecular formula C10H18N4O6S and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-amino-3-[2-carboxy-2-(methylamino)ethyl]sulfanylpropanoic acid;imidazolidine-2,4-dione.
| Compound Name | 2-amino-3-[2-carboxy-2-(methylamino)ethyl]sulfanylpropanoic acid;imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 174963643 |
| Molecular Formula | C10H18N4O6S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-amino-3-[2-carboxy-2-(methylamino)ethyl]sulfanylpropanoic acid;imidazolidine-2,4-dione |
| SMILES | CNC(CSCC(N)C(=O)O)C(=O)O.O=C1CNC(=O)N1 |
| InChI | InChI=1S/C7H14N2O4S.C3H4N2O2/c1-9-5(7(12)13)3-14-2-4(8)6(10)11;6-2-1-4-3(7)5-2/h4-5,9H,2-3,8H2,1H3,(H,10,11)(H,12,13);1H2,(H2,4,5,6,7) |
| InChIKey | BEYMSHIOYDNZDD-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|