[1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate

C7H8F2N2O2 — CID 174963798

IUPAC[1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate
SMILESO=COC(Cc1ncc[nH]1)C(F)F
InChIInChI=1S/C7H8F2N2O2/c8-7(9)5(13-4-12)3-6-10-1-2-11-6/h1-2,4-5,7H,3H2,(H,10,11)
InChIKeyKYRYEWOTSRAHNA-UHFFFAOYSA-N
MW190.15 g/mol
LogP0.76
Rot. Bonds5

About [1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate

[1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate (PubChem CID 174963798) has the molecular formula C7H8F2N2O2 and a molecular weight of 190.15 g/mol. Its IUPAC name is [1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate.

Molecular Properties

Compound Name[1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate
PubChem CID174963798
Molecular FormulaC7H8F2N2O2
Molecular Weight190.15 g/mol
Exact Mass190.06
IUPAC Name[1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate
SMILESO=COC(Cc1ncc[nH]1)C(F)F
InChIInChI=1S/C7H8F2N2O2/c8-7(9)5(13-4-12)3-6-10-1-2-11-6/h1-2,4-5,7H,3H2,(H,10,11)
InChIKeyKYRYEWOTSRAHNA-UHFFFAOYSA-N
XLogP0.76
TPSA54.98 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.15
LogP ≤ 50.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze [1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate?
The IUPAC name of [1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate (CID 174963798) is [1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate.
What is the SMILES notation for [1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate?
The canonical SMILES for [1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate is O=COC(Cc1ncc[nH]1)C(F)F.
What is the InChIKey of [1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate?
The InChIKey is KYRYEWOTSRAHNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2O2/c8-7(9)5(13-4-12)3-6-10-1-2-11-6/h1-2,4-5,7H,3H2,(H,10,11).
What are the key properties of [1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate?
[1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate has a molecular weight of 190.15 g/mol, XLogP of 0.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1-difluoro-3-(1H-imidazol-2-yl)propan-2-yl] formate is sourced from PubChem (CID 174963798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).