C11H26O4Si — CID 174963921
ethyl 2,4-dihydroxy-2-methylpentanoate;prop-1-ene;silane (PubChem CID 174963921) has the molecular formula C11H26O4Si and a molecular weight of 250.41 g/mol. Its IUPAC name is ethyl 2,4-dihydroxy-2-methylpentanoate;prop-1-ene;silane.
| Compound Name | ethyl 2,4-dihydroxy-2-methylpentanoate;prop-1-ene;silane |
|---|---|
| PubChem CID | 174963921 |
| Molecular Formula | C11H26O4Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | ethyl 2,4-dihydroxy-2-methylpentanoate;prop-1-ene;silane |
| SMILES | C=CC.CCOC(=O)C(C)(O)CC(C)O.[SiH4] |
| InChI | InChI=1S/C8H16O4.C3H6.H4Si/c1-4-12-7(10)8(3,11)5-6(2)9;1-3-2;/h6,9,11H,4-5H2,1-3H3;3H,1H2,2H3;1H4 |
| InChIKey | AWUYNOUQDZEEMO-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|