About 3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide
3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide (PubChem CID 174963963) has the molecular formula C6H8N4O
and a molecular weight of 152.16 g/mol. Its IUPAC name is 3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide |
| PubChem CID | 174963963 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide |
| SMILES | CC1(C#N)NNC=C1C(N)=O |
| InChI | InChI=1S/C6H8N4O/c1-6(3-7)4(5(8)11)2-9-10-6/h2,9-10H,1H3,(H2,8,11) |
| InChIKey | BQPCSSBUTYHPJS-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide?
The IUPAC name of 3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide (CID 174963963) is 3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide.
What is the SMILES notation for 3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide?
The canonical SMILES for 3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide is CC1(C#N)NNC=C1C(N)=O.
What is the InChIKey of 3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide?
The InChIKey is BQPCSSBUTYHPJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O/c1-6(3-7)4(5(8)11)2-9-10-6/h2,9-10H,1H3,(H2,8,11).
What are the key properties of 3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide?
3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide has a molecular weight of 152.16 g/mol, XLogP of -1.25, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-3-methyl-1,2-dihydropyrazole-4-carboxamide is sourced from PubChem (CID 174963963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).