About 2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine
2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine (PubChem CID 174964397) has the molecular formula C5H8FNO
and a molecular weight of 117.12 g/mol. Its IUPAC name is 2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine.
Molecular Properties
| Compound Name | 2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine |
| PubChem CID | 174964397 |
| Molecular Formula | C5H8FNO |
| Molecular Weight | 117.12 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | 2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine |
| SMILES | CN1C=COC(F)C1 |
| InChI | InChI=1S/C5H8FNO/c1-7-2-3-8-5(6)4-7/h2-3,5H,4H2,1H3 |
| InChIKey | IHJGNBMALWZUOU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.12 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine?
The IUPAC name of 2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine (CID 174964397) is 2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine.
What is the SMILES notation for 2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine?
The canonical SMILES for 2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine is CN1C=COC(F)C1.
What is the InChIKey of 2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine?
The InChIKey is IHJGNBMALWZUOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FNO/c1-7-2-3-8-5(6)4-7/h2-3,5H,4H2,1H3.
What are the key properties of 2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine?
2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine has a molecular weight of 117.12 g/mol, XLogP of 0.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-methyl-2,3-dihydro-1,4-oxazine is sourced from PubChem (CID 174964397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).