C12H22O2 — CID 174964430
1-(2,3-dimethyloxolan-2-yl)hexan-1-one (PubChem CID 174964430) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(2,3-dimethyloxolan-2-yl)hexan-1-one.
| Compound Name | 1-(2,3-dimethyloxolan-2-yl)hexan-1-one |
|---|---|
| PubChem CID | 174964430 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 1-(2,3-dimethyloxolan-2-yl)hexan-1-one |
| SMILES | CCCCCC(=O)C1(C)OCCC1C |
| InChI | InChI=1S/C12H22O2/c1-4-5-6-7-11(13)12(3)10(2)8-9-14-12/h10H,4-9H2,1-3H3 |
| InChIKey | XYGDRYXSUCSABZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|