C26H22N2O4S — CID 174964701
[3-(phenylcarbamoyl)-5-propan-2-ylthiophen-2-yl]carbamoyl naphthalene-1-carboxylate (PubChem CID 174964701) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is [3-(phenylcarbamoyl)-5-propan-2-ylthiophen-2-yl]carbamoyl naphthalene-1-carboxylate.
| Compound Name | [3-(phenylcarbamoyl)-5-propan-2-ylthiophen-2-yl]carbamoyl naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 174964701 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [3-(phenylcarbamoyl)-5-propan-2-ylthiophen-2-yl]carbamoyl naphthalene-1-carboxylate |
| SMILES | CC(C)c1cc(C(=O)Nc2ccccc2)c(NC(=O)OC(=O)c2cccc3ccccc23)s1 |
| InChI | InChI=1S/C26H22N2O4S/c1-16(2)22-15-21(23(29)27-18-11-4-3-5-12-18)24(33-22)28-26(31)32-25(30)20-14-8-10-17-9-6-7-13-19(17)20/h3-16H,1-2H3,(H,27,29)(H,28,31) |
| InChIKey | SZHNOZQUSMKOLZ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|