About 1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene
1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene (PubChem CID 174964887) has the molecular formula C15H25N3S
and a molecular weight of 279.45 g/mol. Its IUPAC name is 1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene.
Molecular Properties
| Compound Name | 1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene |
| PubChem CID | 174964887 |
| Molecular Formula | C15H25N3S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene |
| SMILES | CC(C)N1CCCC1.Cn1cccn1.c1ccsc1 |
| InChI | InChI=1S/C7H15N.C4H6N2.C4H4S/c1-7(2)8-5-3-4-6-8;1-6-4-2-3-5-6;1-2-4-5-3-1/h7H,3-6H2,1-2H3;2-4H,1H3;1-4H |
| InChIKey | AIHLXOWWHNOZLK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene?
The IUPAC name of 1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene (CID 174964887) is 1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene.
What is the SMILES notation for 1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene?
The canonical SMILES for 1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene is CC(C)N1CCCC1.Cn1cccn1.c1ccsc1.
What is the InChIKey of 1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene?
The InChIKey is AIHLXOWWHNOZLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.C4H6N2.C4H4S/c1-7(2)8-5-3-4-6-8;1-6-4-2-3-5-6;1-2-4-5-3-1/h7H,3-6H2,1-2H3;2-4H,1H3;1-4H.
What are the key properties of 1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene?
1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene has a molecular weight of 279.45 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrazole;1-propan-2-ylpyrrolidine;thiophene is sourced from PubChem (CID 174964887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).