About 2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate
2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate (PubChem CID 174964933) has the molecular formula C14H13Cl2N3O3
and a molecular weight of 342.18 g/mol. Its IUPAC name is 2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate.
Molecular Properties
| Compound Name | 2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate |
| PubChem CID | 174964933 |
| Molecular Formula | C14H13Cl2N3O3 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate |
| SMILES | COc1nc(N)c(CCOC=O)nc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H13Cl2N3O3/c1-21-14-12(8-3-2-4-9(15)11(8)16)18-10(13(17)19-14)5-6-22-7-20/h2-4,7H,5-6H2,1H3,(H2,17,19) |
| InChIKey | XLNWVVLHLROVKV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate?
The IUPAC name of 2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate (CID 174964933) is 2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate.
What is the SMILES notation for 2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate?
The canonical SMILES for 2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate is COc1nc(N)c(CCOC=O)nc1-c1cccc(Cl)c1Cl.
What is the InChIKey of 2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate?
The InChIKey is XLNWVVLHLROVKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2N3O3/c1-21-14-12(8-3-2-4-9(15)11(8)16)18-10(13(17)19-14)5-6-22-7-20/h2-4,7H,5-6H2,1H3,(H2,17,19).
What are the key properties of 2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate?
2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate has a molecular weight of 342.18 g/mol, XLogP of 2.76, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-amino-6-(2,3-dichlorophenyl)-5-methoxypyrazin-2-yl]ethyl formate is sourced from PubChem (CID 174964933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).